Anodyne| DNP | |
|---|---|
 | |
| Molecular structure via molpic |
| Physical properties [] | |
|---|---|
| Molecular mass | 184.11 g/mol [1] |
| Density | 1.68 at 68 °F (USCG, 1999) - Denser than water; will sink g/cm3 [1] |
| Appearance | Pale yellow platelets or leaflets from water [1] |
| Odor | SWEET, MUSTY ODOR [1] |
| Taste | BITTER TASTE [1] |
| Predicted LogP | 1.7 [1] |
| Melting point | 234 to 237 °F (NTP, 1992) [1] |
| Boiling point | Sublimes (when carefully heated) (NTP, 1992) [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitroxides/. [1] |
| Solubility | >27.6 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C6H4N2O5 [1] |
| IUPAC name | 2,4-dinitrophenol [1] |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])O [1] |
| InChI | InChI=1S/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H [1] |
| InChIKey | UFBJCMHMOXMLKC-UHFFFAOYSA-N [1] |
| Dosing | |
|---|---|
| Elimination half-life | Unknown |
2,4-Dinitrophenol
2,4-Dinitrophenol (also known as Aldifen, Phenol, 2,4-dinitro-, Nitrophene, Fenoxyl carbon N, Solfo Black B, Dinofan, Tertrosulphur PBR, α-Dinitrophenol, Dinitrophenol or Solfo Black G) is a substance of the phenol class.