1,3-Butanediol
| 1,3-BDO | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 90.12 g/mol [1] |
| Density | 1.0053 g/cu cm at 20 °C g/cm3 [1] |
| Appearance | Viscous liquid [1] |
| Odor | Practically odorless [1] |
| Taste | Sweet flavor with bitter aftertaste [1] |
| Melting point | < -50 °C [1] |
| Boiling point | 207.5 °C [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | Miscible with water [1] |
| Predicted LogP | -0.4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C4H10O2 [1] |
| IUPAC name | butane-1,3-diol [1] |
| SMILES | CC(CCO)O [1] |
| InChI | InChI=1S/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3 [1] |
| InChIKey | PUPZLCDOIYMWBV-UHFFFAOYSA-N [1] |
1,3-Butanediol (also known as 1,3-Butanediol, Butane-1,3-diol, 1,3-Butylene glycol, Butylene glycol, 1,3-Dihydroxybutane, Methyltrimethylene glycol, 1,3 Butylene glycol, 1,3-Butandiol, β-Butylene glycol or 1-Methyl-1,3-propanediol)
Chemistry
Stereochemistry []
1,3-Butanediol is a racemic mixture of the enantiomers.
| Stereoisomerism |
|---|
| Stereoisomer enumberation with rdkit |
Subjective effects []
See also []
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 7896, 1,3-Butanediol. Accessed July 28, 2025. https://pubchem.ncbi.nlm.nih.gov/compound/7896