GABA | |
---|---|
Salts [] | |
---|---|
γ-Aminobutyric acid hydrochloride | |
Molecular structure via molpic | |
Molecular formula | C4H9NO2[1] |
---|---|
Molecular mass | 103.12 g/mol[1] |
Predicted LogP | -3.2[1] |
Melting point | 203 °C[1] |
Solubility | 1.2 [ug/mL] (The mean of the results at pH 7.4)[1] |
Chirality | achiral[2] |
Identifiers [] | |
---|---|
IUPAC name | 4-aminobutanoic acid[1] |
SMILES | C(CC(=O)O)CN[1] |
InChI | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)[1] |
InChIKey | BTCSSZJGUNDROE-UHFFFAOYSA-N[1] |
Dosing |
---|
γ-Aminobutyric acid
γ-Aminobutyric acid (also known as 4-Aminobutanoic acid, Piperidic acid, Piperidinic acid, Aminalon, Gaballon, γlone, γsol, Mielomade, Gamarex or γr) is a substance of the gabapentinoid class.
Chemistry
γ-Aminobutyric acid is typically found in the form of its hydrochloride salt.
Stereochemistry
γ-Aminobutyric acid is a achiral mixture
Subjective effects
See also
External links
- γ-Aminobutyric acid (Wikipedia)
- γ-Aminobutyric acid (Wikidata)
- γ-Aminobutyric acid (DrugBank)
- γ-Aminobutyric acid (PubChem)
- γ-Aminobutyric acid (ChEMBL)
- γ-Aminobutyric acid (ChEBI)
- γ-Aminobutyric acid (Common Chemistry)
- γ-Aminobutyric acid (HMDB)
- γ-Aminobutyric acid (KEGG)
- γ-Aminobutyric acid (UNII)
- γ-Aminobutyric acid (EPA DSSTox)