Tetrodotoxin
| Tetrodotoxin | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 319.27 g/mol [1] |
| Appearance | Crystals [1] |
| Melting point | 225 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /Nitrogen oxide/. [1] |
| Solubility | Soluble in dilute acetic acid; slightly soluble in dry alcohol, ether; practically insoluble in other organic solvents [1] |
| Predicted LogP | -5.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C11H17N3O8 [1] |
| IUPAC name | (1R,5R,6R,7R,9S,11S,12S,13S,14S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol [1] |
| SMILES | C([C@@]1([C@H]2[C@@H]3[C@H](N=C(N[C@@]34[C@@H]([C@@H]1O[C@]([C@H]4O)(O2)O)O)N)O)O)O [1] |
| InChI | InChI=1S/C11H17N3O8/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5/h2-7,15-20H,1H2,(H3,12,13,14)/t2-,3-,4-,5+,6-,7+,9+,10-,11+/m1/s1 [1] |
| InChIKey | CFMYXEVWODSLAX-QOZOJKKESA-N [1] |
Tetrodotoxin (also known as Spheroidine, Tarichatoxin, Tetrodotoxine, Babylonia japonica toxin 1, Tetrodoxin, Tectin, BJT 1, Maculotoxin, Pft-1 toxin or tetrodotoxina) is a
Chemistry
Stereochemistry []
Tetrodotoxin is a absolute mixture