Δ-9-tetrahydrocannabinol
| THC | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 314.5 g/mol [1] |
| Appearance | Light yellow resinous oil [1] |
| Melting point | 200 °C [1] |
| Boiling point | 392 ° [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | 2.8 mg/L at 73 °F (NTP, 1992) [1] |
| Predicted LogP | 7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H30O2 [1] |
| IUPAC name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol [1] |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C=C(CC[C@H]3C(OC2=C1)(C)C)C)O [1] |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h11-13,16-17,22H,5-10H2,1-4H3/t16-,17-/m1/s1 [1] |
| InChIKey | CYQFCXCEBYINGO-IAGOWNOFSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 1.6–59 h, 25–36 h (orally administered dronabinol) |
(Redirected from tetrahydrocannabinol)
Δ-9-tetrahydrocannabinol (also known as Dronabinol, Tetrahydrocannabinol, Δ9-Tetrahydrocannabinol, Δ9-THC, Δnyne, Abbott 40566, Δ-9-THC, Δ(9)-THC, Dronabinolum or Δ1-THC) is a
Chemistry
Stereochemistry []
Δ-9-tetrahydrocannabinol is a absolute mixture
Pharmacology
ATC Classification
In the alimentary tract and metabolism (A) δ-9-tetrahydrocannabinol actsMetabolism
Subjective effects []
Legal status []
- Brazil: Δ-9-tetrahydrocannabinol is a Dronabinol: A3; THC <30mg/ml: A3; others: F2 (prohibited). substance.
- Canada: Δ-9-tetrahydrocannabinol is a Unscheduled substance.
- Germany: Δ-9-tetrahydrocannabinol is a Dronabinol: II, other isomers and their stereochemical variants: I. substance.
- United Kingdom: Δ-9-tetrahydrocannabinol is a Class B substance.
- United Nations: Δ-9-tetrahydrocannabinol is a Schedule I drug under the "Convention on Psychotropic Substances 1971".