Saxitoxin
| Saxitoxin | |
|---|---|
| Esters [] | |
|---|---|
| Saxitoxin acetate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 299.29 g/mol [1] |
| Predicted LogP | -4.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H17N7O4 [1] |
| IUPAC name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate [1] |
| SMILES | C1CN2C(=N[C@H]([C@H]3[C@]2(C1(O)O)NC(=N3)N)COC(=O)N)N [1] |
| InChI | InChI=1S/C10H17N7O4/c11-6-15-5-4(3-21-8(13)18)14-7(12)17-2-1-9(19,20)10(5,17)16-6/h4-5,19-20H,1-3H2,(H2,12,14)(H2,13,18)(H3,11,15,16)/t4-,5-,10-/m0/s1 [1] |
| InChIKey | RPQXVSUAYFXFJA-HGRQIUPRSA-N [1] |
Saxitoxin (also known as Saxitoxin hydrate, Gonyaulax catenella poison, Saxidomus giganteus poison, Mytilus californianus poison, (+)-Saxitoxin, [(3aS,4R,10aS)-10,10-dihydroxy-2,6-diiminooctahydro-1H,8H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate, [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate, 1H,10H-Pyrrolo(1,2-c)purine-10,10-diol, 2,6-diamino-4-(((amino-carbonyl)oxy)methyl)-3a,4,8,9-tetrahydro-, (3aS-(3a-α,4-α,10aR*)), 1H,10H-Pyrrolo(1,2-c)purine-10,10-diol, 2,6-diamino-4-(((aminocarbonyl)oxy)methyl)-3a,4,8,9-tetrahydro-, (3aS,4R,10aS)- or 1H,10H-Pyrrolo(1,2-c)purine-10,10-diol, 2,6-diamino-4-(((aminocarbonyl)oxy)methyl)-3a,4,8,9-tetrahydro-, (3aS-(3aα,4α,10aR*))-) is a neurotoxin substance of the amino acid class.
Chemistry
Esters []
Saxitoxin is typically found in the form of its acetate ester.
Stereochemistry []
Saxitoxin is a absolute mixture