Anodyne| PG | |
|---|---|
 |
| Esters [] | |
|---|---|
| Propylene glycol acetate | |
| |
| Propylene glycol dipropionate | |
| |
| Propylene glycol stearate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C3H8O2[1] |
|---|---|
| Molecular mass | 76.09 g/mol[1] |
| Density | 1.04 at 68 °F (USCG, 1999) - Denser than water; will sink g/cm3[1] |
| Appearance | Colorless viscous liquid[1] |
| Odor | Practically odorless[1] |
| Taste | Practically tasteless[1] |
| Predicted LogP | -0.9[1] |
| Melting point | -76 °F (NTP, 1992)[1] |
| Boiling point | 370.8 °[1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes.[1] |
| Solubility | greater than or equal to 100 mg/mL at 70 °F (NTP, 1992)[1] |
| Chirality | racemic[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | propane-1,2-diol[1] |
| SMILES | CC(CO)O[1] |
| InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3[1] |
| InChIKey | DNIAPMSPPWPWGF-UHFFFAOYSA-N[1] |
| Dosing |
|---|
Propylene glycol
Propylene glycol (also known as 1,2-propanediol, 1,2-Propylene glycol, 1,2-dihydroxypropane, 2-Hydroxypropanol, Isopropylene glycol, Methylethyl glycol, Methylethylene glycol, Monopropylene glycol, Dowfrost or Sirlene) is a substance of the alcohol class.
Chemistry
Propylene glycol is typically found in the form of its acetate, dipropionate and stearate esters.
Stereochemistry
(RS)-Propylene glycol is a racemic mixture of the optical stereoisomers:
| Stereoisomers [] |
|---|
|
(+)-Propylene glycol -propylene_glycol.svg)
(-)-Propylene glycol -propylene_glycol.svg)
|
See also
External links
- Propylene glycol (Wikipedia)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (Wikidata)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (DrugBank)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (PubChem)
- Propylene glycol (ChEMBL)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (ChEBI)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (Common Chemistry)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (KEGG)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (UNII)
- Propylene glycol / (+)-Propylene glycol / (-)-Propylene glycol (EPA DSSTox)