| Paraquat | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 186.25 g/mol [1] |
| Density | 1.24 g/cm3 [1] |
| Appearance | Yellow solid [1] |
| Odor | Odorless [1] |
| Melting point | Colorless crystals; mp: 300 °C (decomposes); very soluble in water, slightly soluble in lower alcohols. Insoluble in hydrocarbons. Hydrolyzed by alkali. Inactivated by inert clays and anionic surfactants; corrosive to metal; non-volatile /Paraquat dichloride/ [1] |
| Boiling point | Boiling point (760 mm Hg): Decomposes at 175-180 °C (347-356 °F) [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitric oxides/. [1] |
| Solubility | In water, 6.2X10+5 mg/L at 20 °C [1] |
| Predicted LogP | 1.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H14N2+2 [1] |
| IUPAC name | 1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium [1] |
| SMILES | C[N+]1=CC=C(C=C1)C2=CC=[N+](C=C2)C [1] |
| InChI | InChI=1S/C12H14N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3-10H,1-2H3/q+2 [1] |
| InChIKey | INFDPOAKFNIJBF-UHFFFAOYSA-N [1] |
Paraquat
Paraquat (also known as Paraquat ion, 1,1'-Dimethyl-4,4'-bipyridinium, Paraquat dication, Dimethyl viologen, 4,4'-Bipyridinium, 1,1'-dimethyl-, Methyl viologen, Starfire, Weedol, Spraytop-graze or Dextrone X)
Chemistry
Stereochemistry []
Paraquat is a achiral mixture
Anodyne