L-Norpseudoephedrine
| L-Norpseudoephedrine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 151.21 g/mol [1] |
| Appearance | White, crystalline powder [1] |
| Odor | Slight aromatic odor [1] |
| Melting point | 190-194 °C [1] |
| Decomposition | When heated to decomposition it emits very toxic fumes of nitroxides. [1] |
| Solubility | Freely soluble [1] |
| Predicted LogP | 0.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H13NO [1] |
| IUPAC name | (1R,2R)-2-amino-1-phenylpropan-1-ol [1] |
| SMILES | C[C@H]([C@@H](C1=CC=CC=C1)O)N [1] |
| InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m1/s1 [1] |
| InChIKey | DLNKOYKMWOXYQA-APPZFPTMSA-N [1] |
(Redirected from norpseudoephedrine)
L-Norpseudoephedrine (also known as (-)-NORPSEUDOEPHEDRINE, Norpseudoephedrine, 37577-07-4, l-Pseudonorephedrine, NORPSEUDOEPHEDRINE, (-)-, QQ0FVC4PXS, (R,R)-(-)-Norpseudoephedrine, l-Nor-psi-ephedrine, NORPSEUDOEPHEDRINE, L- or (-)-threo-2-Amino-2-methyl-1-phenylethanol)
Chemistry
Stereochemistry []
L-Norpseudoephedrine is a absolute mixture.