Lefetamine
| Lefetamine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 225.33 g/mol [1] |
| Predicted LogP | 3.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C16H19N [1] |
| IUPAC name | (1R)-N,N-dimethyl-1,2-diphenylethanamine [1] |
| SMILES | CN(C)[C@H](CC1=CC=CC=C1)C2=CC=CC=C2 [1] |
| InChI | InChI=1S/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m1/s1 [1] |
| InChIKey | YEJZJVJJPVZXGX-MRXNPFEDSA-N [1] |
Lefetamine (also known as Lefetamina, Lephetamine, Lefetaminum, (-)-N,N-Dimethyl-1,2-diphenylethylamine, Ethylamine, n,n-dimethyl-1,2-diphenyl-, (-)-, Benzeneethanamine, N,N-dimethyl-α-phenyl-, (R)-, Benzeneethanamine, N,N-dimethyl-α-phenyl-, (αR)-, Santenol, lephetamine, hydrochloride or ojkdjkuslnknel-uhfffaoysa-n) is a
Chemistry
Salts []
Lefetamine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Lefetamine is a absolute mixture.
Subjective effects []
Legal status []
- Australia: Lefetamine is a S4 substance.
- Brazil: Lefetamine is a B1 substance.
- Canada: Lefetamine is a Schedule III substance.
- United States: Lefetamine is a Schedule IV substance.
- United Kingdom: Lefetamine is a Class B substance.
- Germany: Lefetamine is a Anlage I substance.