Isoxsuprine
| Isoxsuprine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 301.4 g/mol [1] |
| Predicted LogP | 2.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H23NO3 [1] |
| IUPAC name | 4-[1-hydroxy-2-(1-phenoxypropan-2-ylamino)propyl]phenol [1] |
| SMILES | CC(COC1=CC=CC=C1)NC(C)C(C2=CC=C(C=C2)O)O [1] |
| InChI | InChI=1S/C18H23NO3/c1-13(12-22-17-6-4-3-5-7-17)19-14(2)18(21)15-8-10-16(20)11-9-15/h3-11,13-14,18-21H,12H2,1-2H3 [1] |
| InChIKey | BMUKKTUHUDJSNZ-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | <3 hours (horses) |
Isoxsuprine (also known as Dilavase, Duvadilan, Isoxuprine, 1-(p-hydroxyphenyl)-1-propanol, Benzenemethanol, 4-hydroxy-.α.-[1-[(1-methyl-2-phenoxyethyl)amino]ethyl]-, Benzyl alcohol, p-hydroxy-.α.-(1-((1-methyl-2-phenoxyethyl)amino)ethyl)-, Dilator, Vasodilan, Prestwick0_000068 or Prestwick1_000068) is a sympathomimetic substance of the phenylethanolamine class.
Stereochemistry []
Isoxsuprine is a