Glutamine
| Gln | |
|---|---|
| Esters [] | |
|---|---|
| Glutamine acetate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 146.14 g/mol [1] |
| Predicted LogP | -3.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C5H10N2O3 [1] |
| IUPAC name | 2,5-diamino-5-oxopentanoic acid [1] |
| SMILES | C(CC(=O)N)C(C(=O)O)N [1] |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10) [1] |
| InChIKey | ZDXPYRJPNDTMRX-UHFFFAOYSA-N [1] |
Glutamine (also known as DL-Glutamine, 585-21-7, glutamin, H-DL-Gln-OH, 2-amino-4-carbamoylbutanoic acid, .γ.-Glutamine, (+/-)-Glutamine;DL-Gl, γ-Glutamine, d(-)-glutamine or Glutamine DL-form) is a
Chemistry
Esters []
Glutamine is typically found in the form of its acetate ester.
Stereochemistry []
DL-Glutamine is a racemic mixture of the logical stereoisomers.
Subjective effects []
Legal status []
- United States: Glutamine is a prescription only substance.