Anodyne| E1 | |
|---|---|
 |
| Esters [] | |
|---|---|
| Estrone acetate | |
| |
| Estrone benzoate | |
| |
| Estrone propionate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C18H22O2[1] |
|---|---|
| Molecular mass | 270.4 g/mol[1] |
| Density | 1.236 g/cu cm at 25 °C g/cm3[1] |
| Appearance | Small, white crystals, or white to creamy white, crystalline powder[1] |
| Odor | Odorless[1] |
| Predicted LogP | 3.1[1] |
| Melting point | 258-261 °C[1] |
| Decomposition | When heated to decomposition it emits acrid smoke and fumes.[1] |
| Solubility | Slightly soluble in ethanol, ethyl ether, benzene; soluble in acetone, dioxane[1] |
| Chirality | absolute[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one[1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)O[1] |
| InChI | InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-16,19H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1[1] |
| InChIKey | DNXHEGUUPJUMQT-CBZIJGRNSA-N[1] |
| Dosing |
|---|
Estrone
Estrone (also known as folliculin, Thelykinin, Ketohydroxyestrin, Estrugenone, Estron, Tokokin, 1,3,5(10)-Estratrien-3-ol-17-one, Disynformon, Folliculine or Follicunodis) is a substance of the steroid class.
Chemistry
Estrone is typically found in the form of its acetate, benzoate and propionate esters.
Stereochemistry
Estrone is a absolute mixture