Disopyramide
| Disopyramide | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 339.5 g/mol [1] |
| Melting point | 94.5-95 °C [1] |
| Solubility | 4.93e-02 g/L [1] |
| Predicted LogP | 3.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H29N3O [1] |
| IUPAC name | 4-[di(propan-2-yl)amino]-2-phenyl-2-pyridin-2-ylbutanamide [1] |
| SMILES | CC(C)N(CCC(C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N)C(C)C [1] |
| InChI | InChI=1S/C21H29N3O/c1-16(2)24(17(3)4)15-13-21(20(22)25,18-10-6-5-7-11-18)19-12-8-9-14-23-19/h5-12,14,16-17H,13,15H2,1-4H3,(H2,22,25) [1] |
| InChIKey | UVTNFZQICZKOEM-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 6.7 hours (range 4 to 10 hours) |
Disopyramide (also known as Dicorantil, Disopiramida, Isorythm, Ritmodan, Lispine, Rythmodan P, Searle 703, Disopyramidum, Dl-disopyramide or SC 7031) is a sodium channel blocker substance of the amphetamine class.
Chemistry
Salts []
Disopyramide is typically found in the form of its phosphate salt.
Stereochemistry []
(RS)-Disopyramide is a racemic mixture of the optical stereoisomers
Pharmacology
ATC Classification
Metabolism
Subjective effects []
Legal status []
- Brazil: Disopyramide is a C1 substance.
- United Kingdom: Disopyramide is a prescription only substance.
- United States: Disopyramide is a prescription only substance.