Anodyne| Cys | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Cysteine acetate | |
|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 121.16 g/mol [1] |
| Predicted LogP | -2.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C3H7NO2S [1] |
| IUPAC name | 2-amino-3-sulfanylpropanoic acid [1] |
| SMILES | C(C(C(=O)O)N)S [1] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) [1] |
| InChIKey | XUJNEKJLAYXESH-UHFFFAOYSA-N [1] |
Cysteine
Cysteine (also known as DL-Cysteine, 2-Amino-3-mercaptopropanoic acid, DL-Cystein, Cysteine, dl-, (+/-)-2-Amino-3-mercaptopropionic acid, 150146-94-4, L-hsch2ch(nh2)cooh, H-Cys-OH HCl HO, Ncgc00160365-01 or (+-)-Cysteine) is a
Chemistry
Salts and Esters []
Cysteine is typically found in the form of its monohydrate and hydrochloride salts
or its acetate ester.
Stereochemistry []
DL-Cysteine is a racemic mixture of the logical stereoisomers