Cumene
| Cumene | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 120.19 g/mol [1] |
| Density | 0.866 at 59 °F (USCG, 1999) - Less dense than water; will float g/cm3 [1] |
| Appearance | Colorless liquid [1] |
| Odor | Gasoline-like odor [1] |
| Melting point | -140.9 °F (USCG, 1999) [1] |
| Boiling point | 306.3 ° [1] |
| Decomposition | Hazardous decomposition products: Toxic gases and vapors (such as carbon monoxide) may be released. [1] |
| Solubility | Insoluble (NIOSH, 2024) [1] |
| Predicted LogP | 3.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H12 [1] |
| IUPAC name | cumene [1] |
| SMILES | CC(C)C1=CC=CC=C1 [1] |
| InChI | InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3 [1] |
| InChIKey | RWGFKTVRMDUZSP-UHFFFAOYSA-N [1] |
Cumene (also known as Isopropylbenzene, 2-Phenylpropane, (1-Methylethyl)benzene, Benzene, (1-methylethyl)-, Cumol, Isopropylbenzol, Cumeen, Isopropilbenzene, Isopropylbenzeen or 2-Fenilpropano) is a
Chemistry
Stereochemistry []
Cumene is a achiral mixture.
Subjective effects []
See also []
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 7406, Cumene. Accessed August 1, 2025. https://pubchem.ncbi.nlm.nih.gov/compound/7406