Colterol
| Colterol | |
|---|---|
| Esters [] | |
|---|---|
| Colterol acetate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 225.28 g/mol [1] |
| Predicted LogP | -0.4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H19NO3 [1] |
| IUPAC name | 4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol [1] |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)O)O [1] |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8/h4-6,11,13-16H,7H2,1-3H3 [1] |
| InChIKey | PHSMOUBHYUFTDM-UHFFFAOYSA-N [1] |
Colterol (also known as Colterolum, (+-)-N-tert-Butylarterenol, (+-)-N-t-Butylnoradrenaline, dl-N-tert-Butylnorepinephrine, (+-)-tert-Butyl noradrenaline, KWD 2026, WIN-5563, S 1541, S-1541 or dl-1-(3,4-Dihydroxyphenyl)-2-tert-butylaminoethanol) is a sympathomimetic substance of the phenylethanolamine and catecholamine class.
Chemistry
Salts and Esters []
Colterol is typically found in the form of its mesylate salt
or its acetate ester.
Stereochemistry []
(RS)-Colterol is a racemic mixture of the optical stereoisomers.