Anodyne| Buphenine | |
|---|---|
 | |
| Molecular structure via molpic |
| Physical properties [] | |
|---|---|
| Molecular mass | 299.4 g/mol [1] |
| Appearance | Crystals from methanol [1] |
| Odor | ODORLESS [1] |
| Taste | TASTELESS [1] |
| Predicted LogP | 3.5 [1] |
| Melting point | 111 °C [1] |
| Solubility | Mol wt 335.88. Crystals. Sparingly sol in water; slightly sol in alcohol. Practically insol in ether, chloroform, benzene /Hydrochloride/ [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H25NO2 [1] |
| IUPAC name | 4-[1-hydroxy-2-(4-phenylbutan-2-ylamino)propyl]phenol [1] |
| SMILES | CC(CCC1=CC=CC=C1)NC(C)C(C2=CC=C(C=C2)O)O [1] |
| InChI | InChI=1S/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 [1] |
| InChIKey | PTGXAUBQBSGPKF-UHFFFAOYSA-N [1] |
| Dosing |
|---|
Buphenine
Buphenine (also known as nylidrin, Buphenin, Nilidrine, Suprifen-psb, Nylidrinum, Phenyl-sec-butyl norsuprifen, SKF 1700-A, Benzenemethanol, 4-hydroxy-α-(1-((1-methyl-3-phenylpropyl)amino)ethyl)-, CS 6712 or p-Hydroxy-N-(1-methyl-3-phenylpropyl)norephedrine) is a substance of the phenylethanolamine class.