Anodyne| β-Carboline | |
|---|---|
 |
| Salts [] | |
|---|---|
| β-Carboline hydrochloride | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C11H8N2 |
|---|---|
| Molecular mass | 168.19 g/mol |
| Predicted LogP | 3.2 |
| Melting point | 199 °C |
| Solubility | >25.2 [ug/mL] (The mean of the results at pH 7.4) |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 9H-pyrido[3,4-b]indole |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 |
| InChI | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
| InChIKey | AIFRHYZBTHREPW-UHFFFAOYSA-N |
| Dosing |
|---|
β-Carboline
β-Carboline (also known as 9H-Pyrido[3,4-B]indole, Norharman, Norharmane, 2,9-Diazafluorene, Carbazoline, 9H-β-carboline, 2-Azacarbazole, 2H-Pyrido[3,4-b]indole, .β.-Carboline or Nor Harmane) is a substance of the beta-carboline class.
Chemistry
β-Carboline is typically found in the form of its hydrochloride salt.
Stereochemistry
β-Carboline is a achiral mixturePharmacology
| Predicted binding sites (SwissTargetPredictions)[] | ||
|---|---|---|
| Target | Target Class | Probability |
| Sodium-dependent Norepinephrine | Transporter | 0.43 |
| Sodium-dependent Serotonin | Transporter | 0.43 |
| Sodium-dependent Dopamine | Transporter | 0.43 |
| Trace amine-associated | Receptor 1 | 0.43 |
| Trace amine-associated | Receptor 2 | 0.43 |
| Monoamine oxidase | Enzyme A | 0.34 |
| Monoamine oxidase | Enzyme B | 0.34 |
| Sigma non-opioid intracellular | Receptor 1 | 0.34 |
| Serotonin | Receptor 2A | 0.30 |
| Serotonin | Receptor 2C | 0.30 |