Adenosine
| A | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 267.24 g/mol [1] |
| Appearance | Needles (from water +3/2) [1] |
| Odor | Odorless [1] |
| Taste | Mild, saline, or bitter taste [1] |
| Melting point | 235.5 °C [1] |
| Decomposition | When heated to decomposition, it emits toxic funes of /nitrogen oxides/. [1] |
| Solubility | >40.1 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | -1.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H13N5O4 [1] |
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol [1] |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N [1] |
| InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 [1] |
| InChIKey | OIRDTQYFTABQOQ-KQYNXXCUSA-N [1] |
Adenosine (also known as Adenine riboside, β-D-Adenosine, Nucleocardyl, Adenosin, Sandesin, Boniton, Myocol, Adenine nucleoside, Adenocor or β-Adenosine)
Chemistry
Stereochemistry []
Adenosine is a absolute mixture.