Valine
| Val | |
|---|---|
| Esters [] | |
|---|---|
| Valine acetate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 117.15 g/mol [1] |
| Solubility | Soluble in water; Insoluble in ether [1] |
| Predicted LogP | -2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C5H11NO2 [1] |
| IUPAC name | 2-amino-3-methylbutanoic acid [1] |
| SMILES | CC(C)C(C(=O)O)N [1] |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) [1] |
| InChIKey | KZSNJWFQEVHDMF-UHFFFAOYSA-N [1] |
Valine (also known as DL-Valine, 2-Amino-3-methylbutanoic acid, FEMA No. 3444, CCRIS 8604, D,L-VALINE, D,l-valine, AI3-18308, Valine, DL, 2Aminoisovaleric acid, DL or αAminoisovaleric acid, DL) is a
Chemistry
Esters []
Valine is typically found in the form of its acetate ester.
Stereochemistry []
DL-Valine is a racemic mixture of the logical stereoisomers