Phenylbutazone | |
---|---|
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Conformer structure via JSmol |
Physical properties [] | |
---|---|
Molecular mass | 308.4 g/mol [1] |
Appearance | Crystals from ethanol [1] |
Odor | ODORLESS [1] |
Taste | Slightly bitter taste [1] |
Melting point | 219 to 225 °F (NTP, 1992) [1] |
Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
Solubility | >46.3 [ug/mL] (The mean of the results at pH 7.4) [1] |
Predicted LogP | 3.2 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C19H20N2O2 [1] |
IUPAC name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione [1] |
SMILES | CCCCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 [1] |
InChI | InChI=1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 [1] |
InChIKey | VYMDGNCVAMGZFE-UHFFFAOYSA-N [1] |
Phenylbutazone
Phenylbutazone (also known as 4-Butyl-1,2-diphenylpyrazolidine-3,5-dione, Butapirazol, Butazolidin, Fenilbutazona, Butadion, Diphenylbutazone, Butazolidine, Fenibutazona, Fenylbutazon or Intrabutazone)
Chemistry
Stereochemistry []
Phenylbutazone is a achiral mixture