| PFOA | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 414.07 g/mol [1] |
| Density | 1.792 g/mL at 20 °C g/cm3 [1] |
| Appearance | White to off-white powder [1] |
| Melting point | 54.3 °C [1] |
| Boiling point | 192 °C [1] |
| Decomposition | When heated to decomposition it emits toxic vapors of /flourine/. [1] |
| Solubility | When heated to decomposition it emits toxic vapors of F(-). [1] |
| Predicted LogP | 4.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C8HF15O2 [1] |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid [1] |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O [1] |
| InChI | InChI=1S/C8HF15O2/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h(H,24,25) [1] |
| InChIKey | SNGREZUHAYWORS-UHFFFAOYSA-N [1] |
Perfluorooctanoic acid
(Redirected from Perfluorooctanoic acid)Perfluorooctanoic acid (also known as Pentadecafluorooctanoic acid, Perfluorocaprylic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanoic acid, Octanoic acid, pentadecafluoro-, Perfluoroctanoic acid, Perfluoro-n-octanoic acid, Perfluoroheptanecarboxylic acid, Pentadecafluoro-1-octanoic acid, Pentadecafluoro-n-octanoic acid or n-perfluorooctanoic acid) is a
Chemistry
Stereochemistry []
Perfluorooctanoic acid is a achiral mixture
Anodyne