Anodyne| Nandrolone | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Nandrolone acetate | |
| |
| Nandrolone benzoate | |
| |
| Nandrolone cypionate | |
| |
| Nandrolone undecylate | |
| |
| Nandrolone propionate | |
|
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 274.4 g/mol [1] |
| Appearance | Dimorphic crystals [1] |
| Melting point | 112 and 124 °C [1] |
| Solubility | Soluble in ether, chloroform, and alcohol [1] |
| Predicted LogP | 2.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H26O2 [1] |
| IUPAC name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one [1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@H]34 [1] |
| InChI | InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1 [1] |
| InChIKey | NPAGDVCDWIYMMC-IZPLOLCNSA-N [1] |
| Dosing [] | |
|---|---|
| Elimination half-life | • Nandrolone: <4.3 hours • Nandrolone decanoate (Intramuscular injection): 6–12 days • Nandrolone phenylpropionate: 2.7 days |
| Duration of action | • Nandrolone decanoate (Intramuscular injection): 2–3 weeks • Nandrolone phenylpropionate (Intramuscular injection): 5–7 days |
Nandrolone
Nandrolone (also known as 19-Nortestosterone, 19-Norandrostenolone, Norandrostenolone, Nortestosterone, Menidrabol, Nandrolon, Nortestonate, Oestrenolon, Norandrostenolon or 17β-Hydroxy-4-estren-3-one) is a
Chemistry
Esters []
Nandrolone is typically found in the form of its acetate, benzoate, cypionate, undecylate and propionate esters.
Stereochemistry []
Nandrolone is a absolute mixture
Legal status
- Brazil: Nandrolone is a C5 substance.
- Canada: Nandrolone is a Schedule IV substance.
- United Kingdom: Nandrolone is a Class C substance.
- United States: Nandrolone is a Schedule III substance.