Anodyne| Mifepristone | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 429.6 g/mol [1] |
| Appearance | Yellow powder [1] |
| Melting point | 191-196 °C [1] |
| Solubility | 7 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 3.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C29H35NO2 [1] |
| IUPAC name | (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one [1] |
| SMILES | CC#C[C@@]1(CC[C@@H]2[C@@]1(C[C@@H](C3=C4CCC(=O)C=C4CC[C@@H]23)C5=CC=C(C=C5)N(C)C)C)O [1] |
| InChI | InChI=1S/C29H35NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h6-7,9-10,17,24-26,32H,8,11-14,16,18H2,1-4H3/t24-,25+,26-,28-,29-/m0/s1 [1] |
| InChIKey | VKHAHZOOUSRJNA-GCNJZUOMSA-N [1] |
Mifepristone
Mifepristone (also known as RU-486, Korlym, RU486, RU 486, Mifepristona, Mifepriston, RU 38486, RU-38486, Mifepristonum or CCRIS 9332) is a
Chemistry
Stereochemistry []
Mifepristone is a absolute mixture
Legal status
- Australia: Mifepristone is a S4 substance.
- Canada: Mifepristone is a prescription only substance.
- United States: Mifepristone is a prescription only substance.