Homovanillyl alcohol
| Homovanillyl alcohol | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 168.19 g/mol [1] |
| Melting point | 40 - 42 °C [1] |
| Predicted LogP | 0.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H12O3 [1] |
| IUPAC name | 4-(2-hydroxyethyl)-2-methoxyphenol [1] |
| SMILES | COC1=C(C=CC(=C1)CCO)O [1] |
| InChI | InChI=1S/C9H12O3/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,10-11H,4-5H2,1H3 [1] |
| InChIKey | XHUBSJRBOQIZNI-UHFFFAOYSA-N [1] |
(Redirected from Homovanillyl alcohol)
Homovanillyl alcohol (also known as 4-(2-Hydroxyethyl)-2-methoxyphenol, 3-Methoxy-4-hydroxyphenylethanol, Benzeneethanol, 4-hydroxy-3-methoxy-, MOPET, 4-(2-Hydroxyethyl)guaiacol, Xhubsjrboqizni-uhfffaoysa-, Hydroxymethoxyphenethyl Alcohol, Alcohol, Hydroxymethoxyphenethyl, 3 Methoxy 4 hydroxyphenylethanol or inchi=1/c9h12o3/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,10-11h,4-5h2,1h3) is a neurotransmitter metabolite substance of the alcohol class.
Chemistry
Stereochemistry []
Homovanillyl alcohol is a achiral mixture.