Anodyne| Adrenaline | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Epinephrine acetate | |
|
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 183.20 g/mol [1] |
| Solubility | Soluble [1] |
| Predicted LogP | -1.4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H13NO3 [1] |
| IUPAC name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol [1] |
| SMILES | CNCC(C1=CC(=C(C=C1)O)O)O [1] |
| InChI | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 [1] |
| InChIKey | UCTWMZQNUQWSLP-UHFFFAOYSA-N [1] |
| Sublingual [] | |
|---|---|
| Threshold | 0.3 μg |
| Light | 0.3 μg |
| Common | 0.3 μg |
| Strong | 0.3 μg |
| Heavy | 0.3 μg |
| Statistically derived dosages by Sernyl |
Epinephrine
Epinephrine (also known as DL-Adrenaline, Racepinephrine, (+-)-Adrenaline, Epinephrine dl-, Epinephrine, dl-, Racemic Epinephrine, Epinephrine dl-form, Racemic adrenaline, Adrenaline, racemic or Epinephrine, Racemic) is a neurotransmitters substance of the phenylethanolamine and catecholamine class.
Chemistry
Salts and Esters []
Epinephrine is typically found in the form of its hydrochloride, sulfate, acetate and bitartrate salts
or its ester.
Stereochemistry []
(RS)-Epinephrine is a racemic mixture of the optical stereoisomers