Anodyne| Dimethocaine | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Conformer structure via JSmol | |
| Physical properties [] | |
|---|---|
| Molecular mass | 278.39 g/mol [1] |
| Predicted LogP | 3.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C16H26N2O2 [1] |
| IUPAC name | [3-(diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate [1] |
| SMILES | CCN(CC)CC(C)(C)COC(=O)C1=CC=C(C=C1)N [1] |
| InChI | InChI=1S/C16H26N2O2/c1-5-18(6-2)11-16(3,4)12-20-15(19)13-7-9-14(17)10-8-13/h7-10H,5-6,11-12,17H2,1-4H3 [1] |
| InChIKey | OWQIUQKMMPDHQQ-UHFFFAOYSA-N [1] |
Dimethocaine
Dimethocaine (also known as Larocaine, 3-(Diethylamino)-2,2-dimethylpropyl 4-aminobenzoate, R3L4A6GOWZ, 1-Propanol, 3-(diethylamino)-2,2-dimethyl-, p-aminobenzoate, DIMETHOCAINE [MI], (3-Diethylamino-2,2-dimethyl)propyl 4-aminobenzoat, 1-Propanol, 3-(diethylamino)-2,2-dimethyl-, 4-aminobenzoate (ester), 1-Propanol, 3-(diethylamino)-2,2-dimethyl-, p-aminobenzoate (ester), DIMETHOCAINE [WHO-DD] or 4-Aminobenzoesaeure-3-diethylamino-2,2-dimethylproplylester)
Chemistry
Salts []
Dimethocaine is typically found in the form of its salicylate salt.
Stereochemistry []
Dimethocaine is a achiral mixture
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Dimethocaine[freebase][citrate] via Intravenous and Vaporized | strong numbing effect both in veins and mouth; mild Euphoria; pleasant vaporized |