| Bitolterol | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 461.5 g/mol [1] |
| Predicted LogP | 5.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C28H31NO5 [1] |
| IUPAC name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate [1] |
| SMILES | CC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C(CNC(C)(C)C)O)OC(=O)C3=CC=C(C=C3)C [1] |
| InChI | InChI=1S/C28H31NO5/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21/h6-16,23,29-30H,17H2,1-5H3 [1] |
| InChIKey | FZGVEKPRDOIXJY-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Duration of action | 6–8 hours |
Bitolterol
Bitolterol (also known as Bitolterolum, WIN 32784, S 1540, 4-(2-(tert-Butylamino)-1-hydroxyethyl-1,2-phenylen di-4-toluat, 4-(2-(tert-Butylamino)-1-hydroxyethyl-o-phenylene di-p-toluate, 4-[2-(tert-Butylamino)-1-hydroxyethyl]-o-phenylene di-p-toluate, 4-(2-(tert-butylamino)-1-hydroxyethyl)-1,2-phenylene bis(4-methylbenzoate), Benzoic acid, 4-methyl-, 4-(2-((1,1-dimethylethyl)amino)-1-hydroxyethyl)-1,2-phenylene ester, S-1540 or 4-(2-(tert-butylamino)-1-hydroxyethyl)-o-phenylene di-p-toluate) is a sympathomimetic substance of the phenylethanolamine and catecholamine class.
Chemistry
Salts []
Bitolterol is typically found in the form of its mesylate salt.
Stereochemistry []
(RS)-Bitolterol is a racemic mixture of the optical stereoisomers
Legal status []
- United States: Bitolterol is a Discontinued substance.