Anodyne| Asp | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Aspartic acid acetate | |
|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 133.10 g/mol [1] |
| Predicted LogP | -2.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C4H7NO4 [1] |
| IUPAC name | 2-aminobutanedioic acid [1] |
| SMILES | C(C(C(=O)O)N)C(=O)O [1] |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) [1] |
| InChIKey | CKLJMWTZIZZHCS-UHFFFAOYSA-N [1] |
Aspartic acid
(Redirected from Aspartic acid)Aspartic acid (also known as Dl-aspartic acid, DL-Aminosuccinic acid, DL-Asparagic acid, DL-Asp-OH, Acid D,L-aspart, (+-)-Aspartic acid, (R,S)-Aspartic acid, (+/-)-2-Aminosuccinic acid, (+/-)-Aspartic Acid or L-aspartic-4-13c acid) is a
Chemistry
Esters []
Aspartic acid is typically found in the form of its acetate ester.
Stereochemistry []
DL-Aspartic acid is a racemic mixture of the logical stereoisomers