Anodyne| Amobarbital | |
|---|---|
 |
| Salts [] | |
|---|---|
| Sodium amobarbital | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C11H18N2O3[1] |
|---|---|
| Molecular mass | 226.27 g/mol[1] |
| Appearance | Crystals[1] |
| Odor | Odorless[1] |
| Taste | Slightly bitter[1] |
| Predicted LogP | 2.1[1] |
| Melting point | 313 to 316 °F (NTP, 1992)[1] |
| Decomposition | When heated to decomposition, it emits toxic fumes of /nitric oxides/.[1] |
| Solubility | less than 1 mg/mL at 65.3 °F (NTP, 1992)[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 5-ethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione[1] |
| SMILES | CCC1(C(=O)NC(=O)NC1=O)CCC(C)C[1] |
| InChI | InChI=1S/C11H18N2O3/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16)[1] |
| InChIKey | VIROVYVQCGLCII-UHFFFAOYSA-N[1] |
| Dosing | |
|---|---|
| Elimination half-life | 8–42 hours |
Amobarbital
Amobarbital (also known as Amylobarbitone, Isomytal, Amylobarbital, Barbamil, Amobarbitone, Amylbarbitone, Talamo, Barbamyl acid, Binoctal or Dorlotyn) is a substance of the barbiturate class.
Chemistry
Amobarbital is typically found in the form of its sodium salt.
Stereochemistry
Amobarbital is a achiral mixture
Legal status
- Brazil: Amobarbital is a B1 substance.
- Canada: Amobarbital is a Schedule IV substance.
- Germany: Amobarbital is a Anlage III substance.
- United States: Amobarbital is a Schedule II substance.
- United Kingdom: Amobarbital is a Class B substance.
- United Nations: Amobarbital is a Schedule III drug under the "Convention on Psychotropic Substances 1971".