5-Hydroxy-N,N-diethyltryptamine
| 5-HO-DET | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 232.32 g/mol [1] |
| Predicted LogP | 1.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C14H20N2O [1] |
| IUPAC name | 3-[2-(diethylamino)ethyl]-1H-indol-5-ol [1] |
| SMILES | CCN(CC)CCC1=CNC2=C1C=C(C=C2)O [1] |
| InChI | InChI=1S/C14H20N2O/c1-3-16(4-2)8-7-11-10-15-14-6-5-12(17)9-13(11)14/h5-6,9-10,15,17H,3-4,7-8H2,1-2H3 [1] |
| InChIKey | DLKZNHHXBDWTOP-UHFFFAOYSA-N [1] |
5-Hydroxy-N,N-diethyltryptamine (also known as Indole, 3-(2-(diethylamino)ethyl)-5-hydroxy-, 5-Hydroxy diethyl tryptamine, Indole-3-ethylamine, N,N-diethyl-5-hydroxy-, 4-22-00-05676 or 3-(2-Diethylamino-ethyl)-1H-indol-5-ol) is a psychedelic substance of the tryptamine class.
Stereochemistry []
5-Hydroxy-N,N-diethyltryptamine is a