| MDAI | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 177.20 g/mol [1] |
| Predicted LogP | 1.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H11NO2 [1] |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[f][1,3]benzodioxol-6-amine [1] |
| SMILES | C1C(CC2=CC3=C(C=C21)OCO3)N [1] |
| InChI | InChI=1S/C10H11NO2/c11-8-1-6-3-9-10(13-5-12-9)4-7(6)2-8/h3-4,8H,1-2,5,11H2 [1] |
| InChIKey | FQDRMHHCWZAXJM-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Duration of action | 2–6 hours |
5,6-Methylenedioxy-2-aminoindane
5,6-Methylenedioxy-2-aminoindane (also known as 5,6-Methylenedioxy-2-aminoindan, 6,7-dihydro-5H-indeno[5,6-d][1,3]dioxol-6-amine, 5H-Indeno[5,6-d]-1,3-dioxol-6-amine, 6,7-dihydro-, MDAI; 5,6-Methylenedioxy-2-aminoindane, 5H-Indeno(5,6-d)-1,3-dioxol-6-amine, 6,7-dihydro-, 6,7-Dihydro-5h-cyclopenta(f)(1,3)benzodioxol-6-amine, 2,2',4,4'-Tetranitrobiphenyl; 2,4,2',4'-Tetranitrobiphenyl; NSC 97248, 6,7-Dihydro-5H-indeno(5,6-d)-1,3-dioxol-6-amine, 6,7-Dihydro-5H-indeno[5,6-d][1,3]dioxol-6-ylamine or Fqdrmhhcwzaxjm-uhfffaoysa-n) is a
Chemistry
Salts []
5,6-Methylenedioxy-2-aminoindane is typically found in the form of its hydrochloride salt.
Stereochemistry []
5,6-Methylenedioxy-2-aminoindane is a achiral mixture
Legal status
- Brazil: 5,6-Methylenedioxy-2-aminoindane is a F2 substance.
- Germany: 5,6-Methylenedioxy-2-aminoindane is a Neuer-Psychoaktiver-Stoff under the "Neue-psychoaktive-Stoffe-Gesetz (NpSG)".
- United Kingdom: 5,6-Methylenedioxy-2-aminoindane is a PSA substance.
Anodyne