Anodyne| MDA | |
|---|---|
 |
| Salts [] | |
|---|---|
| 3,4-Methylenedioxyamphetamine hydrochloride | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C10H13NO2[1] |
|---|---|
| Molecular mass | 179.22 g/mol[1] |
| Appearance | Almost colorless oil[1] |
| Predicted LogP | 1.6[1] |
| Boiling point | 157 °C[1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /Nitrogen oxides/.[1] |
| Chirality | racemic[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 1-(1,3-benzodioxol-5-yl)propan-2-amine[1] |
| SMILES | CC(CC1=CC2=C(C=C1)OCO2)N[1] |
| InChI | InChI=1S/C10H13NO2/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5,7H,4,6,11H2,1H3[1] |
| InChIKey | NGBBVGZWCFBOGO-UHFFFAOYSA-N[1] |
| Dosing |
|---|
3,4-Methylenedioxyamphetamine
3,4-Methylenedioxyamphetamine (also known as Tenamfetamine, Methylenedioxyamphetamine, 3,4-Methylenedioxy-amphetamine, Tenamfetamine, MDA (pharmaceutical), Tenamfetamina, Tenamfetaminum, methylene dioxyamphetamine, 1,3-Benzodioxole-5-ethanamine, alpha-methyl- or Tenanfetamina) is a substance of the amphetamine class.
Chemistry
3,4-Methylenedioxyamphetamine is typically found in the form of its hydrochloride salt.
Stereochemistry
3,4-Methylenedioxyamphetamine is a racemic mixture of the optical stereoisomers:
| Stereoisomers [] |
|---|
|
(+)-3,4-Methylenedioxyamphetamine -3,4-methylenedioxyamphetamine.svg)
(-)-3,4-Methylenedioxyamphetamine -3,4-methylenedioxyamphetamine.svg)
|
See also
- Hallucinogens
- Antidepressant
- Depressant
- Amphetamine
- Substituted amphetamines
- Substituted methylenedioxyphenethylamines
- Anodyne