Anodyne| MDPiHP | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Physical properties [] | |
|---|---|
| Molecular mass | 289.4 g/mol [1] |
| Predicted LogP | 3.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C17H23NO3 [1] |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-4-methyl-2-pyrrolidin-1-ylpentan-1-one [1] |
| SMILES | CC(C)CC(C(=O)C1=CC2=C(C=C1)OCO2)N3CCCC3 [1] |
| InChI | InChI=1S/C17H23NO3/c1-12(2)9-14(18-7-3-4-8-18)17(19)13-5-6-15-16(10-13)21-11-20-15/h5-6,10,12,14H,3-4,7-9,11H2,1-2H3 [1] |
| InChIKey | VRQRDQWKORSFMZ-UHFFFAOYSA-N [1] |
3,4-Methylenedioxy-α-pyrrolidinoisohexanophenone
3,4-Methylenedioxy-α-pyrrolidinoisohexanophenone (also known as MDPIHP, 3,4-Methylenedioxy pihp, 1-(1,3-Benzodioxol-5-yl)-4-methyl-2-(1-pyrrolidinyl)-1-pentanone, 1-Pentanone, 1-(1,3-benzodioxol-5-yl)-4-methyl-2-(1-pyrrolidinyl)- or 1-(1,3-benzodioxol-5-yl)-4-methyl-2-pyrrolidin-1-yl-pentan-1-one) is a stimulant substance of the pyrrolidinophenone and methylenedioxyphenethylamine class.
Chemistry
Salts []
3,4-Methylenedioxy-α-pyrrolidinoisohexanophenone is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-3,4-Methylenedioxy-α-pyrrolidinoisohexanophenone is a racemic mixture of the optical stereoisomers
Subjective effects
| Anodyne Usernotes [] | |
|---|---|
| 0xea / 3,4-Methylenedioxy-α-pyrrolidinoisohexanophenone[hydrochloride] via Insufflated and Intravenous | Strong Stimulation; Strong Euphoria; Moderately Entactogenic; Moderate Duration Insufflated |