2-Amino-4,5-diphenyloxazole
| 2-Amino-4,5-diphenyloxazole | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 236.27 g/mol [1] |
| Solubility | >35.4 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 3.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H12N2O [1] |
| IUPAC name | 4,5-diphenyl-1,3-oxazol-2-amine [1] |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)N)C3=CC=CC=C3 [1] |
| InChI | InChI=1S/C15H12N2O/c16-15-17-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17) [1] |
| InChIKey | WRXUDNPJNMUPKL-UHFFFAOYSA-N [1] |
2-Amino-4,5-diphenyloxazole (also known as 2-Adpo, 2-Oxazolamine, 4,5-diphenyl-, 4,5-Diphenyl-oxazol-2-ylamine, diphenyl-1,3-oxazol-2-amine, 4,5-Diphenyl-1,3-oxazol-2-amine, 4,5-Diphenyloxazol-2-amine, 2-Oxazolamine,4,5-diphenyl-, Mls000780354, Smr000420537 or 4,5-diphenyl-2-oxazolamine) is a
Stereochemistry []
2-Amino-4,5-diphenyloxazole is a